C14H22N4O3S — CID 109340046
N-butyl-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyrimidine-4-carboxamide (PubChem CID 109340046) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-butyl-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyrimidine-4-carboxamide.
| Compound Name | N-butyl-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109340046 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-butyl-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyrimidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(N(C)C2CCS(=O)(=O)C2)ncn1 |
| InChI | InChI=1S/C14H22N4O3S/c1-3-4-6-15-14(19)12-8-13(17-10-16-12)18(2)11-5-7-22(20,21)9-11/h8,10-11H,3-7,9H2,1-2H3,(H,15,19) |
| InChIKey | YSZQMXUKHKZYQO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|