C20H17F2N3O — CID 113017591
N-[6-(N-ethylanilino)-3-pyridinyl]-3,4-difluorobenzamide (PubChem CID 113017591) has the molecular formula C20H17F2N3O and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[6-(N-ethylanilino)-3-pyridinyl]-3,4-difluorobenzamide.
| Compound Name | N-[6-(N-ethylanilino)-3-pyridinyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113017591 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[6-(N-ethylanilino)-3-pyridinyl]-3,4-difluorobenzamide |
| SMILES | CCN(c1ccccc1)c1ccc(NC(=O)c2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C20H17F2N3O/c1-2-25(16-6-4-3-5-7-16)19-11-9-15(13-23-19)24-20(26)14-8-10-17(21)18(22)12-14/h3-13H,2H2,1H3,(H,24,26) |
| InChIKey | VHTGEFKGLQZIPU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |