C15H13F3N4O3S — CID 113042948
N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2,3,4-trifluorobenzamide (PubChem CID 113042948) has the molecular formula C15H13F3N4O3S and a molecular weight of 386.36 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 113042948 |
| Molecular Formula | C15H13F3N4O3S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)C2)nn1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H13F3N4O3S/c16-10-2-1-9(13(17)14(10)18)15(23)20-12-4-3-11(21-22-12)19-8-5-6-26(24,25)7-8/h1-4,8H,5-7H2,(H,19,21)(H,20,22,23) |
| InChIKey | BEMZNTIHXRAJTC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|