C16H18N4O4S — CID 113042936
N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2-phenoxyacetamide (PubChem CID 113042936) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2-phenoxyacetamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 113042936 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(NC2CCS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C16H18N4O4S/c21-16(10-24-13-4-2-1-3-5-13)18-15-7-6-14(19-20-15)17-12-8-9-25(22,23)11-12/h1-7,12H,8-11H2,(H,17,19)(H,18,20,21) |
| InChIKey | AYZDPKUEGMCCPM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |