C15H15ClN4O3S — CID 113042939
2-chloro-N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]benzamide (PubChem CID 113042939) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is 2-chloro-N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]benzamide.
| Compound Name | 2-chloro-N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113042939 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-chloro-N-[6-[(1,1-dioxothiolan-3-yl)amino]pyridazin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)C2)nn1)c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN4O3S/c16-12-4-2-1-3-11(12)15(21)18-14-6-5-13(19-20-14)17-10-7-8-24(22,23)9-10/h1-6,10H,7-9H2,(H,17,19)(H,18,20,21) |
| InChIKey | GICFMEHLQMBTKK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |