C13H12F3N5O2S — CID 112954949
5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112954949) has the molecular formula C13H12F3N5O2S and a molecular weight of 359.33 g/mol. Its IUPAC name is 5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112954949 |
| Molecular Formula | C13H12F3N5O2S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 5-N-(1,1-dioxothiolan-3-yl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | O=S1(=O)CCC(Nc2cnnc(Nc3ccc(F)c(F)c3F)n2)C1 |
| InChI | InChI=1S/C13H12F3N5O2S/c14-8-1-2-9(12(16)11(8)15)19-13-20-10(5-17-21-13)18-7-3-4-24(22,23)6-7/h1-2,5,7H,3-4,6H2,(H2,18,19,20,21) |
| InChIKey | UJMSLHWRSDBNAM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|