C18H16F3N5 — CID 112964950
3-N-(2,3,4-trifluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112964950) has the molecular formula C18H16F3N5 and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-N-(2,3,4-trifluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,3,4-trifluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112964950 |
| Molecular Formula | C18H16F3N5 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-N-(2,3,4-trifluorophenyl)-5-N-(2,4,6-trimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cc(C)c(Nc2cnnc(Nc3ccc(F)c(F)c3F)n2)c(C)c1 |
| InChI | InChI=1S/C18H16F3N5/c1-9-6-10(2)17(11(3)7-9)24-14-8-22-26-18(25-14)23-13-5-4-12(19)15(20)16(13)21/h4-8H,1-3H3,(H2,23,24,25,26) |
| InChIKey | HEGHQLZDPPTVKB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|