C13H14F3N5 — CID 112940064
5-N-butyl-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112940064) has the molecular formula C13H14F3N5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 5-N-butyl-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-butyl-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940064 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 5-N-butyl-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCNc1cnnc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C13H14F3N5/c1-2-3-6-17-10-7-18-21-13(20-10)19-9-5-4-8(14)11(15)12(9)16/h4-5,7H,2-3,6H2,1H3,(H2,17,19,20,21) |
| InChIKey | BYTNCFORTVZACB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|