C15H8Cl2F3N5 — CID 112969528
5-N-(3,4-dichlorophenyl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112969528) has the molecular formula C15H8Cl2F3N5 and a molecular weight of 386.16 g/mol. Its IUPAC name is 5-N-(3,4-dichlorophenyl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(3,4-dichlorophenyl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112969528 |
| Molecular Formula | C15H8Cl2F3N5 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 5-N-(3,4-dichlorophenyl)-3-N-(2,3,4-trifluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1ccc(Nc2nncc(Nc3ccc(Cl)c(Cl)c3)n2)c(F)c1F |
| InChI | InChI=1S/C15H8Cl2F3N5/c16-8-2-1-7(5-9(8)17)22-12-6-21-25-15(24-12)23-11-4-3-10(18)13(19)14(11)20/h1-6H,(H2,22,23,24,25) |
| InChIKey | DMQZCOABWHGRJC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|