C18H14ClF3N4 — CID 112930108
4-N-(3-chloro-4-methylphenyl)-6-methyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 112930108) has the molecular formula C18H14ClF3N4 and a molecular weight of 378.79 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)-6-methyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)-6-methyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112930108 |
| Molecular Formula | C18H14ClF3N4 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)-6-methyl-2-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(C)c(Cl)c2)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C18H14ClF3N4/c1-9-3-4-11(8-12(9)19)24-15-7-10(2)23-18(26-15)25-14-6-5-13(20)16(21)17(14)22/h3-8H,1-2H3,(H2,23,24,25,26) |
| InChIKey | SGJKUJMOCSCRKG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|