C18H12F6N4 — CID 112931359
6-methyl-2-N-[4-(trifluoromethyl)phenyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 112931359) has the molecular formula C18H12F6N4 and a molecular weight of 398.31 g/mol. Its IUPAC name is 6-methyl-2-N-[4-(trifluoromethyl)phenyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N-[4-(trifluoromethyl)phenyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112931359 |
| Molecular Formula | C18H12F6N4 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 6-methyl-2-N-[4-(trifluoromethyl)phenyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(F)c(F)c2F)nc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H12F6N4/c1-9-8-14(27-13-7-6-12(19)15(20)16(13)21)28-17(25-9)26-11-4-2-10(3-5-11)18(22,23)24/h2-8H,1H3,(H2,25,26,27,28) |
| InChIKey | UCNGWSKZBJMDGJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|