C24H15F9N6 — CID 154659659
2-N,4-N,6-N-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 154659659) has the molecular formula C24H15F9N6 and a molecular weight of 558.41 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 154659659 |
| Molecular Formula | C24H15F9N6 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 2-N,4-N,6-N-tris[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | FC(F)(F)c1ccc(Nc2nc(Nc3ccc(C(F)(F)F)cc3)nc(Nc3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H15F9N6/c25-22(26,27)13-1-7-16(8-2-13)34-19-37-20(35-17-9-3-14(4-10-17)23(28,29)30)39-21(38-19)36-18-11-5-15(6-12-18)24(31,32)33/h1-12H,(H3,34,35,36,37,38,39) |
| InChIKey | JVLOWGCRTOXYQN-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |