C12H8F4N2 — CID 61229555
6-fluoro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 61229555) has the molecular formula C12H8F4N2 and a molecular weight of 256.20 g/mol. Its IUPAC name is 6-fluoro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 61229555 |
| Molecular Formula | C12H8F4N2 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 6-fluoro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | Fc1cccc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C12H8F4N2/c13-10-2-1-3-11(18-10)17-9-6-4-8(5-7-9)12(14,15)16/h1-7H,(H,17,18) |
| InChIKey | HKEJEVQHIRBRFC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|