C17H13F4N5 — CID 158865557
4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 158865557) has the molecular formula C17H13F4N5 and a molecular weight of 363.32 g/mol. Its IUPAC name is 4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 158865557 |
| Molecular Formula | C17H13F4N5 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1c(F)cccc1Nc1ccnc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H13F4N5/c18-12-2-1-3-13(15(12)22)25-14-8-9-23-16(26-14)24-11-6-4-10(5-7-11)17(19,20)21/h1-9H,22H2,(H2,23,24,25,26) |
| InChIKey | JCVLHJFLBPTIPU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|