C16H12F4N6 — CID 22060331
2-N,4-N-bis(3-amino-2,4-difluorophenyl)pyrimidine-2,4-diamine (PubChem CID 22060331) has the molecular formula C16H12F4N6 and a molecular weight of 364.31 g/mol. Its IUPAC name is 2-N,4-N-bis(3-amino-2,4-difluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3-amino-2,4-difluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22060331 |
| Molecular Formula | C16H12F4N6 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-N,4-N-bis(3-amino-2,4-difluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1c(F)ccc(Nc2ccnc(Nc3ccc(F)c(N)c3F)n2)c1F |
| InChI | InChI=1S/C16H12F4N6/c17-7-1-3-9(12(19)14(7)21)24-11-5-6-23-16(26-11)25-10-4-2-8(18)15(22)13(10)20/h1-6H,21-22H2,(H2,23,24,25,26) |
| InChIKey | UEVRPOLQVNXMDL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|