C17H14F4N6 — CID 147001268
4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4,6-triamine (PubChem CID 147001268) has the molecular formula C17H14F4N6 and a molecular weight of 378.33 g/mol. Its IUPAC name is 4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 147001268 |
| Molecular Formula | C17H14F4N6 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-N-(2-amino-3-fluorophenyl)-2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(Nc2cccc(F)c2N)nc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H14F4N6/c18-11-2-1-3-12(15(11)23)25-14-8-13(22)26-16(27-14)24-10-6-4-9(5-7-10)17(19,20)21/h1-8H,23H2,(H4,22,24,25,26,27) |
| InChIKey | ASBRWAOOCJTOMD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|