C14H14F3N3 — CID 102717119
6-N-(2-ethylphenyl)-4-(trifluoromethyl)pyridine-2,6-diamine (PubChem CID 102717119) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 6-N-(2-ethylphenyl)-4-(trifluoromethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(2-ethylphenyl)-4-(trifluoromethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102717119 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-N-(2-ethylphenyl)-4-(trifluoromethyl)pyridine-2,6-diamine |
| SMILES | CCc1ccccc1Nc1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C14H14F3N3/c1-2-9-5-3-4-6-11(9)19-13-8-10(14(15,16)17)7-12(18)20-13/h3-8H,2H2,1H3,(H3,18,19,20) |
| InChIKey | FHIYEGVOPGMGSO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |