C14H15F3N4 — CID 106771302
4-N-(2-propylphenyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine (PubChem CID 106771302) has the molecular formula C14H15F3N4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 4-N-(2-propylphenyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-propylphenyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106771302 |
| Molecular Formula | C14H15F3N4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-N-(2-propylphenyl)-2-(trifluoromethyl)pyrimidine-4,6-diamine |
| SMILES | CCCc1ccccc1Nc1cc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H15F3N4/c1-2-5-9-6-3-4-7-10(9)19-12-8-11(18)20-13(21-12)14(15,16)17/h3-4,6-8H,2,5H2,1H3,(H3,18,19,20,21) |
| InChIKey | SDRKPWOQIALWJC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |