C12H6ClF6N3 — CID 87998594
6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 87998594) has the molecular formula C12H6ClF6N3 and a molecular weight of 341.64 g/mol. Its IUPAC name is 6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 87998594 |
| Molecular Formula | C12H6ClF6N3 |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 6-chloro-2-(trifluoromethyl)-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1ccc(Nc2cc(Cl)nc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H6ClF6N3/c13-8-5-9(22-10(21-8)12(17,18)19)20-7-3-1-6(2-4-7)11(14,15)16/h1-5H,(H,20,21,22) |
| InChIKey | BXLIAZBLXSAXOP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |