C14H12ClF3N2 — CID 102715335
6-chloro-N-(3,4-dimethylphenyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715335) has the molecular formula C14H12ClF3N2 and a molecular weight of 300.71 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dimethylphenyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(3,4-dimethylphenyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715335 |
| Molecular Formula | C14H12ClF3N2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 6-chloro-N-(3,4-dimethylphenyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1ccc(Nc2cc(C(F)(F)F)cc(Cl)n2)cc1C |
| InChI | InChI=1S/C14H12ClF3N2/c1-8-3-4-11(5-9(8)2)19-13-7-10(14(16,17)18)6-12(15)20-13/h3-7H,1-2H3,(H,19,20) |
| InChIKey | YAXQQBWNMRCVEB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|