C12H6ClF3N4 — CID 106766987
2-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 106766987) has the molecular formula C12H6ClF3N4 and a molecular weight of 298.66 g/mol. Its IUPAC name is 2-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 106766987 |
| Molecular Formula | C12H6ClF3N4 |
| Molecular Weight | 298.66 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H6ClF3N4/c13-9-5-10(20-11(19-9)12(14,15)16)18-8-4-2-1-3-7(8)6-17/h1-5H,(H,18,19,20) |
| InChIKey | DEXNTTFXBODGMX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |