C12H7ClF3N5 — CID 106772546
3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-4-chlorobenzonitrile (PubChem CID 106772546) has the molecular formula C12H7ClF3N5 and a molecular weight of 313.67 g/mol. Its IUPAC name is 3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-4-chlorobenzonitrile.
| Compound Name | 3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 106772546 |
| Molecular Formula | C12H7ClF3N5 |
| Molecular Weight | 313.67 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-4-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)c(Nc2cc(N)nc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C12H7ClF3N5/c13-7-2-1-6(5-17)3-8(7)19-10-4-9(18)20-11(21-10)12(14,15)16/h1-4H,(H3,18,19,20,21) |
| InChIKey | ZMQJPYYHWVMZAY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |