C13H8ClF3N4 — CID 106747922
3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4-chlorobenzonitrile (PubChem CID 106747922) has the molecular formula C13H8ClF3N4 and a molecular weight of 312.68 g/mol. Its IUPAC name is 3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4-chlorobenzonitrile.
| Compound Name | 3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 106747922 |
| Molecular Formula | C13H8ClF3N4 |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)c(Nc2cc(C(F)(F)F)ncc2N)c1 |
| InChI | InChI=1S/C13H8ClF3N4/c14-8-2-1-7(5-18)3-10(8)21-11-4-12(13(15,16)17)20-6-9(11)19/h1-4,6H,19H2,(H,20,21) |
| InChIKey | URNYXUGPMTWTHX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |