C13H10BrClN4 — CID 104507044
3-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-4-chlorobenzonitrile (PubChem CID 104507044) has the molecular formula C13H10BrClN4 and a molecular weight of 337.61 g/mol. Its IUPAC name is 3-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-4-chlorobenzonitrile.
| Compound Name | 3-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 104507044 |
| Molecular Formula | C13H10BrClN4 |
| Molecular Weight | 337.61 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-4-chlorobenzonitrile |
| SMILES | Cc1c(N)cnc(Nc2cc(C#N)ccc2Cl)c1Br |
| InChI | InChI=1S/C13H10BrClN4/c1-7-10(17)6-18-13(12(7)14)19-11-4-8(5-16)2-3-9(11)15/h2-4,6H,17H2,1H3,(H,18,19) |
| InChIKey | BNDZJOJBIKNPNH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |