C15H18BrN3 — CID 104506309
3-bromo-4-methyl-2-N-(2-propan-2-ylphenyl)pyridine-2,5-diamine (PubChem CID 104506309) has the molecular formula C15H18BrN3 and a molecular weight of 320.23 g/mol. Its IUPAC name is 3-bromo-4-methyl-2-N-(2-propan-2-ylphenyl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-4-methyl-2-N-(2-propan-2-ylphenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 104506309 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-bromo-4-methyl-2-N-(2-propan-2-ylphenyl)pyridine-2,5-diamine |
| SMILES | Cc1c(N)cnc(Nc2ccccc2C(C)C)c1Br |
| InChI | InChI=1S/C15H18BrN3/c1-9(2)11-6-4-5-7-13(11)19-15-14(16)10(3)12(17)8-18-15/h4-9H,17H2,1-3H3,(H,18,19) |
| InChIKey | UIORIXSBNCKIFW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |