C8H12BrN3 — CID 104506234
3-bromo-2-N-ethyl-4-methylpyridine-2,5-diamine (PubChem CID 104506234) has the molecular formula C8H12BrN3 and a molecular weight of 230.11 g/mol. Its IUPAC name is 3-bromo-2-N-ethyl-4-methylpyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-ethyl-4-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 104506234 |
| Molecular Formula | C8H12BrN3 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 3-bromo-2-N-ethyl-4-methylpyridine-2,5-diamine |
| SMILES | CCNc1ncc(N)c(C)c1Br |
| InChI | InChI=1S/C8H12BrN3/c1-3-11-8-7(9)5(2)6(10)4-12-8/h4H,3,10H2,1-2H3,(H,11,12) |
| InChIKey | GNIJAJFBCPTOKB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |