C10H15BrN4O — CID 104506470
4-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]butanamide (PubChem CID 104506470) has the molecular formula C10H15BrN4O and a molecular weight of 287.16 g/mol. Its IUPAC name is 4-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]butanamide.
| Compound Name | 4-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]butanamide |
|---|---|
| PubChem CID | 104506470 |
| Molecular Formula | C10H15BrN4O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]butanamide |
| SMILES | Cc1c(N)cnc(NCCCC(N)=O)c1Br |
| InChI | InChI=1S/C10H15BrN4O/c1-6-7(12)5-15-10(9(6)11)14-4-2-3-8(13)16/h5H,2-4,12H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | TVLGKXAEGCJIOY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|