C11H18BrN3OS — CID 106244071
1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-2-methyl-3-methylsulfanylpropan-2-ol (PubChem CID 106244071) has the molecular formula C11H18BrN3OS and a molecular weight of 320.26 g/mol. Its IUPAC name is 1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-2-methyl-3-methylsulfanylpropan-2-ol.
| Compound Name | 1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-2-methyl-3-methylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 106244071 |
| Molecular Formula | C11H18BrN3OS |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]-2-methyl-3-methylsulfanylpropan-2-ol |
| SMILES | CSCC(C)(O)CNc1ncc(N)c(C)c1Br |
| InChI | InChI=1S/C11H18BrN3OS/c1-7-8(13)4-14-10(9(7)12)15-5-11(2,16)6-17-3/h4,16H,5-6,13H2,1-3H3,(H,14,15) |
| InChIKey | UTJNMRPLVUWGED-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |