About 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine
3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine (PubChem CID 113420421) has the molecular formula C12H10Br3N3
and a molecular weight of 435.95 g/mol. Its IUPAC name is 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine |
| PubChem CID | 113420421 |
| Molecular Formula | C12H10Br3N3 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 432.84 |
| IUPAC Name | 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine |
| SMILES | Cc1c(N)cnc(Nc2cc(Br)ccc2Br)c1Br |
| InChI | InChI=1S/C12H10Br3N3/c1-6-9(16)5-17-12(11(6)15)18-10-4-7(13)2-3-8(10)14/h2-5H,16H2,1H3,(H,17,18) |
| InChIKey | WECJRXJYWCEOOD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine?
The IUPAC name of 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine (CID 113420421) is 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine.
What is the SMILES notation for 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine?
The canonical SMILES for 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine is Cc1c(N)cnc(Nc2cc(Br)ccc2Br)c1Br.
What is the InChIKey of 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine?
The InChIKey is WECJRXJYWCEOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Br3N3/c1-6-9(16)5-17-12(11(6)15)18-10-4-7(13)2-3-8(10)14/h2-5H,16H2,1H3,(H,17,18).
What are the key properties of 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine?
3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine has a molecular weight of 435.95 g/mol, XLogP of 5.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-N-(2,5-dibromophenyl)-4-methylpyridine-2,5-diamine is sourced from PubChem (CID 113420421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).