C9H7Br2N3S — CID 102767891
2-N-(2,5-dibromophenyl)-1,3-thiazole-2,5-diamine (PubChem CID 102767891) has the molecular formula C9H7Br2N3S and a molecular weight of 349.05 g/mol. Its IUPAC name is 2-N-(2,5-dibromophenyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(2,5-dibromophenyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102767891 |
| Molecular Formula | C9H7Br2N3S |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 346.87 |
| IUPAC Name | 2-N-(2,5-dibromophenyl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(Nc2cc(Br)ccc2Br)s1 |
| InChI | InChI=1S/C9H7Br2N3S/c10-5-1-2-6(11)7(3-5)14-9-13-4-8(12)15-9/h1-4H,12H2,(H,13,14) |
| InChIKey | IAWMCPNZJKWFSZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |