C10H7BrN4S — CID 107787200
4-[(5-amino-1,3-thiazol-2-yl)amino]-3-bromobenzonitrile (PubChem CID 107787200) has the molecular formula C10H7BrN4S and a molecular weight of 295.17 g/mol. Its IUPAC name is 4-[(5-amino-1,3-thiazol-2-yl)amino]-3-bromobenzonitrile.
| Compound Name | 4-[(5-amino-1,3-thiazol-2-yl)amino]-3-bromobenzonitrile |
|---|---|
| PubChem CID | 107787200 |
| Molecular Formula | C10H7BrN4S |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 4-[(5-amino-1,3-thiazol-2-yl)amino]-3-bromobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(N)s2)c(Br)c1 |
| InChI | InChI=1S/C10H7BrN4S/c11-7-3-6(4-12)1-2-8(7)15-10-14-5-9(13)16-10/h1-3,5H,13H2,(H,14,15) |
| InChIKey | KXKKHWHTWZSZKE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |