C15H11BrN4S — CID 107787232
4-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-3-bromobenzonitrile (PubChem CID 107787232) has the molecular formula C15H11BrN4S and a molecular weight of 359.25 g/mol. Its IUPAC name is 4-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-3-bromobenzonitrile.
| Compound Name | 4-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-3-bromobenzonitrile |
|---|---|
| PubChem CID | 107787232 |
| Molecular Formula | C15H11BrN4S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 4-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-3-bromobenzonitrile |
| SMILES | Cc1nc2cc(Nc3ccc(C#N)cc3Br)c(N)cc2s1 |
| InChI | InChI=1S/C15H11BrN4S/c1-8-19-14-6-13(11(18)5-15(14)21-8)20-12-3-2-9(7-17)4-10(12)16/h2-6,20H,18H2,1H3 |
| InChIKey | XEVHKNHBYPPVKV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|