C15H12N4S — CID 43450566
3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]benzonitrile (PubChem CID 43450566) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]benzonitrile.
| Compound Name | 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 43450566 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]benzonitrile |
| SMILES | Cc1nc2cc(Nc3cccc(C#N)c3)c(N)cc2s1 |
| InChI | InChI=1S/C15H12N4S/c1-9-18-14-7-13(12(17)6-15(14)20-9)19-11-4-2-3-10(5-11)8-16/h2-7,19H,17H2,1H3 |
| InChIKey | ZHVZGRJDTSWGCW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|