C14H11Cl2N3S — CID 65468508
5-N-(2,6-dichlorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine (PubChem CID 65468508) has the molecular formula C14H11Cl2N3S and a molecular weight of 324.24 g/mol. Its IUPAC name is 5-N-(2,6-dichlorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-(2,6-dichlorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 65468508 |
| Molecular Formula | C14H11Cl2N3S |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 5-N-(2,6-dichlorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(Nc3c(Cl)cccc3Cl)c(N)cc2s1 |
| InChI | InChI=1S/C14H11Cl2N3S/c1-7-18-12-6-11(10(17)5-13(12)20-7)19-14-8(15)3-2-4-9(14)16/h2-6,19H,17H2,1H3 |
| InChIKey | WAAYEIPZCLIYAZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|