C14H10Cl3N3S — CID 43450525
2-methyl-5-N-(2,4,5-trichlorophenyl)-1,3-benzothiazole-5,6-diamine (PubChem CID 43450525) has the molecular formula C14H10Cl3N3S and a molecular weight of 358.68 g/mol. Its IUPAC name is 2-methyl-5-N-(2,4,5-trichlorophenyl)-1,3-benzothiazole-5,6-diamine.
| Compound Name | 2-methyl-5-N-(2,4,5-trichlorophenyl)-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 43450525 |
| Molecular Formula | C14H10Cl3N3S |
| Molecular Weight | 358.68 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-methyl-5-N-(2,4,5-trichlorophenyl)-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(Nc3cc(Cl)c(Cl)cc3Cl)c(N)cc2s1 |
| InChI | InChI=1S/C14H10Cl3N3S/c1-6-19-13-5-12(10(18)4-14(13)21-6)20-11-3-8(16)7(15)2-9(11)17/h2-5,20H,18H2,1H3 |
| InChIKey | BPTDCIDTSDHDFA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|