C14H10BrF2N3S — CID 107608983
5-N-(4-bromo-2,5-difluorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine (PubChem CID 107608983) has the molecular formula C14H10BrF2N3S and a molecular weight of 370.22 g/mol. Its IUPAC name is 5-N-(4-bromo-2,5-difluorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-(4-bromo-2,5-difluorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 107608983 |
| Molecular Formula | C14H10BrF2N3S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 5-N-(4-bromo-2,5-difluorophenyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(Nc3cc(F)c(Br)cc3F)c(N)cc2s1 |
| InChI | InChI=1S/C14H10BrF2N3S/c1-6-19-13-5-12(10(18)4-14(13)21-6)20-11-3-8(16)7(15)2-9(11)17/h2-5,20H,18H2,1H3 |
| InChIKey | BALWBKYLXGDSIL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|