C10H7N5O2S — CID 57086352
4-amino-3-[(5-nitro-1,3-thiazol-2-yl)amino]benzonitrile (PubChem CID 57086352) has the molecular formula C10H7N5O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-amino-3-[(5-nitro-1,3-thiazol-2-yl)amino]benzonitrile.
| Compound Name | 4-amino-3-[(5-nitro-1,3-thiazol-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 57086352 |
| Molecular Formula | C10H7N5O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 4-amino-3-[(5-nitro-1,3-thiazol-2-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(N)c(Nc2ncc([N+](=O)[O-])s2)c1 |
| InChI | InChI=1S/C10H7N5O2S/c11-4-6-1-2-7(12)8(3-6)14-10-13-5-9(18-10)15(16)17/h1-3,5H,12H2,(H,13,14) |
| InChIKey | SKSAJDLOFUBOQP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|