C12H10N4O2S — CID 104713538
3-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-nitrobenzonitrile (PubChem CID 104713538) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-nitrobenzonitrile.
| Compound Name | 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 104713538 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]-4-nitrobenzonitrile |
| SMILES | Cc1ncc(CNc2cc(C#N)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H10N4O2S/c1-8-14-6-10(19-8)7-15-11-4-9(5-13)2-3-12(11)16(17)18/h2-4,6,15H,7H2,1H3 |
| InChIKey | SOMSHXDLUCKYEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|