C10H11N5O2S — CID 80808195
2-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-nitropyridine-2,6-diamine (PubChem CID 80808195) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is 2-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 80808195 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-nitropyridine-2,6-diamine |
| SMILES | Cc1ncc(CNc2nc(N)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H11N5O2S/c1-6-12-4-7(18-6)5-13-10-8(15(16)17)2-3-9(11)14-10/h2-4H,5H2,1H3,(H3,11,13,14) |
| InChIKey | NTRSNIGJTICDBA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|