C12H12N4O3S — CID 62159905
5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide (PubChem CID 62159905) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide.
| Compound Name | 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 62159905 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide |
| SMILES | Cc1ncc(CNC(=O)c2cc(N)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H12N4O3S/c1-7-14-5-9(20-7)6-15-12(17)10-4-8(13)2-3-11(10)16(18)19/h2-5H,6,13H2,1H3,(H,15,17) |
| InChIKey | RFJFRVRJSIZUKR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|