About 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide
5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide (PubChem CID 62159905) has the molecular formula C12H12N4O3S
and a molecular weight of 292.32 g/mol. Its IUPAC name is 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide.
Molecular Properties
| Compound Name | 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide |
| PubChem CID | 62159905 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide |
| SMILES | Cc1ncc(CNC(=O)c2cc(N)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H12N4O3S/c1-7-14-5-9(20-7)6-15-12(17)10-4-8(13)2-3-11(10)16(18)19/h2-5H,6,13H2,1H3,(H,15,17) |
| InChIKey | RFJFRVRJSIZUKR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide?
The IUPAC name of 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide (CID 62159905) is 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide.
What is the SMILES notation for 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide?
The canonical SMILES for 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide is Cc1ncc(CNC(=O)c2cc(N)ccc2[N+](=O)[O-])s1.
What is the InChIKey of 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide?
The InChIKey is RFJFRVRJSIZUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O3S/c1-7-14-5-9(20-7)6-15-12(17)10-4-8(13)2-3-11(10)16(18)19/h2-5H,6,13H2,1H3,(H,15,17).
What are the key properties of 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide?
5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide has a molecular weight of 292.32 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitrobenzamide is sourced from PubChem (CID 62159905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).