C11H8N4O2S — CID 113444433
4-nitro-3-(1,3-thiazol-2-ylmethylamino)benzonitrile (PubChem CID 113444433) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 4-nitro-3-(1,3-thiazol-2-ylmethylamino)benzonitrile.
| Compound Name | 4-nitro-3-(1,3-thiazol-2-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 113444433 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-nitro-3-(1,3-thiazol-2-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(NCc2nccs2)c1 |
| InChI | InChI=1S/C11H8N4O2S/c12-6-8-1-2-10(15(16)17)9(5-8)14-7-11-13-3-4-18-11/h1-5,14H,7H2 |
| InChIKey | BQRCLNZLJPIWDB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|