C11H12N4O2S — CID 102771504
N-[1-(4-aminophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 102771504) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[1-(4-aminophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102771504 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[1-(4-aminophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | CC(Nc1ncc([N+](=O)[O-])s1)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H12N4O2S/c1-7(8-2-4-9(12)5-3-8)14-11-13-6-10(18-11)15(16)17/h2-7H,12H2,1H3,(H,13,14) |
| InChIKey | MLXXPMHYJVRWRV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|