C11H8N4O5S — CID 3390048
2-(4-nitrophenyl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 3390048) has the molecular formula C11H8N4O5S and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-nitrophenyl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3390048 |
| Molecular Formula | C11H8N4O5S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H8N4O5S/c16-9(13-11-12-6-10(21-11)15(19)20)5-7-1-3-8(4-2-7)14(17)18/h1-4,6H,5H2,(H,12,13,16) |
| InChIKey | OUKHVHGUURTUQS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|