C12H11N5 — CID 79917359
3-[(5-aminopyrimidin-4-yl)amino]-4-methylbenzonitrile (PubChem CID 79917359) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[(5-aminopyrimidin-4-yl)amino]-4-methylbenzonitrile.
| Compound Name | 3-[(5-aminopyrimidin-4-yl)amino]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 79917359 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-[(5-aminopyrimidin-4-yl)amino]-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1Nc1ncncc1N |
| InChI | InChI=1S/C12H11N5/c1-8-2-3-9(5-13)4-11(8)17-12-10(14)6-15-7-16-12/h2-4,6-7H,14H2,1H3,(H,15,16,17) |
| InChIKey | XFNPWOHZQXRODV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |