C14H11N5 — CID 62103720
5-amino-2-(5-cyano-2-methylanilino)pyridine-3-carbonitrile (PubChem CID 62103720) has the molecular formula C14H11N5 and a molecular weight of 249.28 g/mol. Its IUPAC name is 5-amino-2-(5-cyano-2-methylanilino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(5-cyano-2-methylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 62103720 |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-amino-2-(5-cyano-2-methylanilino)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)cc1Nc1ncc(N)cc1C#N |
| InChI | InChI=1S/C14H11N5/c1-9-2-3-10(6-15)4-13(9)19-14-11(7-16)5-12(17)8-18-14/h2-5,8H,17H2,1H3,(H,18,19) |
| InChIKey | XMWSAXLZWJFGKS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |