C13H10Cl2N4 — CID 104725902
5-amino-2-(2,5-dichloro-4-methylanilino)pyridine-3-carbonitrile (PubChem CID 104725902) has the molecular formula C13H10Cl2N4 and a molecular weight of 293.16 g/mol. Its IUPAC name is 5-amino-2-(2,5-dichloro-4-methylanilino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(2,5-dichloro-4-methylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 104725902 |
| Molecular Formula | C13H10Cl2N4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5-amino-2-(2,5-dichloro-4-methylanilino)pyridine-3-carbonitrile |
| SMILES | Cc1cc(Cl)c(Nc2ncc(N)cc2C#N)cc1Cl |
| InChI | InChI=1S/C13H10Cl2N4/c1-7-2-11(15)12(4-10(7)14)19-13-8(5-16)3-9(17)6-18-13/h2-4,6H,17H2,1H3,(H,18,19) |
| InChIKey | KHAOJWHOXSDPRJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |