C11H9ClN6 — CID 80926363
4-chloro-3-[(6-hydrazinylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 80926363) has the molecular formula C11H9ClN6 and a molecular weight of 260.69 g/mol. Its IUPAC name is 4-chloro-3-[(6-hydrazinylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 4-chloro-3-[(6-hydrazinylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 80926363 |
| Molecular Formula | C11H9ClN6 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-chloro-3-[(6-hydrazinylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(Nc2cc(NN)ncn2)c1 |
| InChI | InChI=1S/C11H9ClN6/c12-8-2-1-7(5-13)3-9(8)17-10-4-11(18-14)16-6-15-10/h1-4,6H,14H2,(H2,15,16,17,18) |
| InChIKey | ZIUPPPCMPSCRHV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|