C16H12Cl2N4 — CID 112865738
4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,6-diamine (PubChem CID 112865738) has the molecular formula C16H12Cl2N4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112865738 |
| Molecular Formula | C16H12Cl2N4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,6-diamine |
| SMILES | Clc1ccccc1Nc1cc(Nc2ccccc2Cl)ncn1 |
| InChI | InChI=1S/C16H12Cl2N4/c17-11-5-1-3-7-13(11)21-15-9-16(20-10-19-15)22-14-8-4-2-6-12(14)18/h1-10H,(H2,19,20,21,22) |
| InChIKey | VAYIDNBWXYUROL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |