C14H17ClN4 — CID 112863787
4-N-tert-butyl-6-N-(2-chlorophenyl)pyrimidine-4,6-diamine (PubChem CID 112863787) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 4-N-tert-butyl-6-N-(2-chlorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-tert-butyl-6-N-(2-chlorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112863787 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-N-tert-butyl-6-N-(2-chlorophenyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)(C)Nc1cc(Nc2ccccc2Cl)ncn1 |
| InChI | InChI=1S/C14H17ClN4/c1-14(2,3)19-13-8-12(16-9-17-13)18-11-7-5-4-6-10(11)15/h4-9H,1-3H3,(H2,16,17,18,19) |
| InChIKey | AOBFKCXKHGYKMZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |