C17H14Cl2N4 — CID 112858865
6-N-benzyl-4-N-(2,3-dichlorophenyl)pyrimidine-4,6-diamine (PubChem CID 112858865) has the molecular formula C17H14Cl2N4 and a molecular weight of 345.23 g/mol. Its IUPAC name is 6-N-benzyl-4-N-(2,3-dichlorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-benzyl-4-N-(2,3-dichlorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112858865 |
| Molecular Formula | C17H14Cl2N4 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 6-N-benzyl-4-N-(2,3-dichlorophenyl)pyrimidine-4,6-diamine |
| SMILES | Clc1cccc(Nc2cc(NCc3ccccc3)ncn2)c1Cl |
| InChI | InChI=1S/C17H14Cl2N4/c18-13-7-4-8-14(17(13)19)23-16-9-15(21-11-22-16)20-10-12-5-2-1-3-6-12/h1-9,11H,10H2,(H2,20,21,22,23) |
| InChIKey | CWJNNGSQXVOLNQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |